C16H21F3N2O2 — CID 154714537
tert-butyl 4-[6-(trifluoromethyl)-3-pyridinyl]piperidine-1-carboxylate (PubChem CID 154714537) has the molecular formula C16H21F3N2O2 and a molecular weight of 330.35 g/mol. Its IUPAC name is tert-butyl 4-[6-(trifluoromethyl)-3-pyridinyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[6-(trifluoromethyl)-3-pyridinyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 154714537 |
| Molecular Formula | C16H21F3N2O2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | tert-butyl 4-[6-(trifluoromethyl)-3-pyridinyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccc(C(F)(F)F)nc2)CC1 |
| InChI | InChI=1S/C16H21F3N2O2/c1-15(2,3)23-14(22)21-8-6-11(7-9-21)12-4-5-13(20-10-12)16(17,18)19/h4-5,10-11H,6-9H2,1-3H3 |
| InChIKey | IBZLMJPPQUCIBO-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |