C13H19FO6 — CID 154714874
3-[2-(fluoromethyl)-4,4-bis(methoxycarbonyl)cyclopentyl]propanoic acid (PubChem CID 154714874) has the molecular formula C13H19FO6 and a molecular weight of 290.29 g/mol. Its IUPAC name is 3-[2-(fluoromethyl)-4,4-bis(methoxycarbonyl)cyclopentyl]propanoic acid.
| Compound Name | 3-[2-(fluoromethyl)-4,4-bis(methoxycarbonyl)cyclopentyl]propanoic acid |
|---|---|
| PubChem CID | 154714874 |
| Molecular Formula | C13H19FO6 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 3-[2-(fluoromethyl)-4,4-bis(methoxycarbonyl)cyclopentyl]propanoic acid |
| SMILES | COC(=O)C1(C(=O)OC)CC(CF)C(CCC(=O)O)C1 |
| InChI | InChI=1S/C13H19FO6/c1-19-11(17)13(12(18)20-2)5-8(3-4-10(15)16)9(6-13)7-14/h8-9H,3-7H2,1-2H3,(H,15,16) |
| InChIKey | BBFWTNLMGHKVKE-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|