C15H20F6O4 — CID 162400950
diethyl 3,4-bis(2,2,2-trifluoroethyl)cyclopentane-1,1-dicarboxylate (PubChem CID 162400950) has the molecular formula C15H20F6O4 and a molecular weight of 378.31 g/mol. Its IUPAC name is diethyl 3,4-bis(2,2,2-trifluoroethyl)cyclopentane-1,1-dicarboxylate.
| Compound Name | diethyl 3,4-bis(2,2,2-trifluoroethyl)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 162400950 |
| Molecular Formula | C15H20F6O4 |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | diethyl 3,4-bis(2,2,2-trifluoroethyl)cyclopentane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC(CC(F)(F)F)C(CC(F)(F)F)C1 |
| InChI | InChI=1S/C15H20F6O4/c1-3-24-11(22)13(12(23)25-4-2)5-9(7-14(16,17)18)10(6-13)8-15(19,20)21/h9-10H,3-8H2,1-2H3 |
| InChIKey | IDNMFTQPEQOASQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|