C14H23FO4 — CID 154713324
diethyl 4-fluoro-2,2,4-trimethylcyclopentane-1,1-dicarboxylate (PubChem CID 154713324) has the molecular formula C14H23FO4 and a molecular weight of 274.33 g/mol. Its IUPAC name is diethyl 4-fluoro-2,2,4-trimethylcyclopentane-1,1-dicarboxylate.
| Compound Name | diethyl 4-fluoro-2,2,4-trimethylcyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 154713324 |
| Molecular Formula | C14H23FO4 |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | diethyl 4-fluoro-2,2,4-trimethylcyclopentane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC(C)(F)CC1(C)C |
| InChI | InChI=1S/C14H23FO4/c1-6-18-10(16)14(11(17)19-7-2)9-13(5,15)8-12(14,3)4/h6-9H2,1-5H3 |
| InChIKey | YMPFWINSXGHWOQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|