About dimethyl (4R)-4-(2-fluorophenyl)cyclopent-2-ene-1,1-dicarboxylate
dimethyl (4R)-4-(2-fluorophenyl)cyclopent-2-ene-1,1-dicarboxylate (PubChem CID 154715551) has the molecular formula C15H15FO4
and a molecular weight of 278.28 g/mol. Its IUPAC name is dimethyl (4R)-4-(2-fluorophenyl)cyclopent-2-ene-1,1-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl (4R)-4-(2-fluorophenyl)cyclopent-2-ene-1,1-dicarboxylate |
| PubChem CID | 154715551 |
| Molecular Formula | C15H15FO4 |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | dimethyl (4R)-4-(2-fluorophenyl)cyclopent-2-ene-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C=C[C@H](c2ccccc2F)C1 |
| InChI | InChI=1S/C15H15FO4/c1-19-13(17)15(14(18)20-2)8-7-10(9-15)11-5-3-4-6-12(11)16/h3-8,10H,9H2,1-2H3/t10-/m0/s1 |
| InChIKey | HKSNOCRNTAOLIJ-JTQLQIEISA-N |
| XLogP | 2.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze dimethyl (4R)-4-(2-fluorophenyl)cyclopent-2-ene-1,1-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (4R)-4-(2-fluorophenyl)cyclopent-2-ene-1,1-dicarboxylate?
The IUPAC name of dimethyl (4R)-4-(2-fluorophenyl)cyclopent-2-ene-1,1-dicarboxylate (CID 154715551) is dimethyl (4R)-4-(2-fluorophenyl)cyclopent-2-ene-1,1-dicarboxylate.
What is the SMILES notation for dimethyl (4R)-4-(2-fluorophenyl)cyclopent-2-ene-1,1-dicarboxylate?
The canonical SMILES for dimethyl (4R)-4-(2-fluorophenyl)cyclopent-2-ene-1,1-dicarboxylate is COC(=O)C1(C(=O)OC)C=C[C@H](c2ccccc2F)C1.
What is the InChIKey of dimethyl (4R)-4-(2-fluorophenyl)cyclopent-2-ene-1,1-dicarboxylate?
The InChIKey is HKSNOCRNTAOLIJ-JTQLQIEISA-N. The full InChI is InChI=1S/C15H15FO4/c1-19-13(17)15(14(18)20-2)8-7-10(9-15)11-5-3-4-6-12(11)16/h3-8,10H,9H2,1-2H3/t10-/m0/s1.
What are the key properties of dimethyl (4R)-4-(2-fluorophenyl)cyclopent-2-ene-1,1-dicarboxylate?
dimethyl (4R)-4-(2-fluorophenyl)cyclopent-2-ene-1,1-dicarboxylate has a molecular weight of 278.28 g/mol, XLogP of 2.20, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (4R)-4-(2-fluorophenyl)cyclopent-2-ene-1,1-dicarboxylate is sourced from PubChem (CID 154715551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).