C18H17N5O5 — CID 154717139
2-amino-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-(2-phenylethynyl)-1H-purin-6-one (PubChem CID 154717139) has the molecular formula C18H17N5O5 and a molecular weight of 383.36 g/mol. Its IUPAC name is 2-amino-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-(2-phenylethynyl)-1H-purin-6-one.
| Compound Name | 2-amino-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-(2-phenylethynyl)-1H-purin-6-one |
|---|---|
| PubChem CID | 154717139 |
| Molecular Formula | C18H17N5O5 |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 2-amino-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-(2-phenylethynyl)-1H-purin-6-one |
| SMILES | Nc1nc2c(nc(C#Cc3ccccc3)n2C2OC(CO)C(O)C2O)c(=O)[nH]1 |
| InChI | InChI=1S/C18H17N5O5/c19-18-21-15-12(16(27)22-18)20-11(7-6-9-4-2-1-3-5-9)23(15)17-14(26)13(25)10(8-24)28-17/h1-5,10,13-14,17,24-26H,8H2,(H3,19,21,22,27) |
| InChIKey | SPAJLEIWRUFSPT-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 159.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|