C8H3F8NO — CID 154717791
5-(1,1,2,2,2-pentafluoroethyl)-3-(trifluoromethyl)-1H-pyridin-2-one (PubChem CID 154717791) has the molecular formula C8H3F8NO and a molecular weight of 281.10 g/mol. Its IUPAC name is 5-(1,1,2,2,2-pentafluoroethyl)-3-(trifluoromethyl)-1H-pyridin-2-one.
| Compound Name | 5-(1,1,2,2,2-pentafluoroethyl)-3-(trifluoromethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 154717791 |
| Molecular Formula | C8H3F8NO |
| Molecular Weight | 281.10 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | 5-(1,1,2,2,2-pentafluoroethyl)-3-(trifluoromethyl)-1H-pyridin-2-one |
| SMILES | O=c1[nH]cc(C(F)(F)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C8H3F8NO/c9-6(10,8(14,15)16)3-1-4(7(11,12)13)5(18)17-2-3/h1-2H,(H,17,18) |
| InChIKey | VLWYOHVRJFYFEK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.10 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|