About (1,3-dioxoisoindol-2-yl) cyclohexene-1-carboxylate
(1,3-dioxoisoindol-2-yl) cyclohexene-1-carboxylate (PubChem CID 154718401) has the molecular formula C15H13NO4
and a molecular weight of 271.27 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl) cyclohexene-1-carboxylate.
Molecular Properties
| Compound Name | (1,3-dioxoisoindol-2-yl) cyclohexene-1-carboxylate |
| PubChem CID | 154718401 |
| Molecular Formula | C15H13NO4 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl) cyclohexene-1-carboxylate |
| SMILES | O=C(ON1C(=O)c2ccccc2C1=O)C1=CCCCC1 |
| InChI | InChI=1S/C15H13NO4/c17-13-11-8-4-5-9-12(11)14(18)16(13)20-15(19)10-6-2-1-3-7-10/h4-6,8-9H,1-3,7H2 |
| InChIKey | IHEJHXWIMRFHJC-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (1,3-dioxoisoindol-2-yl) cyclohexene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,3-dioxoisoindol-2-yl) cyclohexene-1-carboxylate?
The IUPAC name of (1,3-dioxoisoindol-2-yl) cyclohexene-1-carboxylate (CID 154718401) is (1,3-dioxoisoindol-2-yl) cyclohexene-1-carboxylate.
What is the SMILES notation for (1,3-dioxoisoindol-2-yl) cyclohexene-1-carboxylate?
The canonical SMILES for (1,3-dioxoisoindol-2-yl) cyclohexene-1-carboxylate is O=C(ON1C(=O)c2ccccc2C1=O)C1=CCCCC1.
What is the InChIKey of (1,3-dioxoisoindol-2-yl) cyclohexene-1-carboxylate?
The InChIKey is IHEJHXWIMRFHJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO4/c17-13-11-8-4-5-9-12(11)14(18)16(13)20-15(19)10-6-2-1-3-7-10/h4-6,8-9H,1-3,7H2.
What are the key properties of (1,3-dioxoisoindol-2-yl) cyclohexene-1-carboxylate?
(1,3-dioxoisoindol-2-yl) cyclohexene-1-carboxylate has a molecular weight of 271.27 g/mol, XLogP of 2.24, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1,3-dioxoisoindol-2-yl) cyclohexene-1-carboxylate is sourced from PubChem (CID 154718401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).