C19H20N3O4+ — CID 54186070
cyclopenten-1-yl-[(cyclopentylideneamino)-(1,3-dioxoisoindol-2-yl)peroxymethylidene]azanium (PubChem CID 54186070) has the molecular formula C19H20N3O4+ and a molecular weight of 354.39 g/mol. Its IUPAC name is cyclopenten-1-yl-[(cyclopentylideneamino)-(1,3-dioxoisoindol-2-yl)peroxymethylidene]azanium.
| Compound Name | cyclopenten-1-yl-[(cyclopentylideneamino)-(1,3-dioxoisoindol-2-yl)peroxymethylidene]azanium |
|---|---|
| PubChem CID | 54186070 |
| Molecular Formula | C19H20N3O4+ |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | cyclopenten-1-yl-[(cyclopentylideneamino)-(1,3-dioxoisoindol-2-yl)peroxymethylidene]azanium |
| SMILES | O=C1c2ccccc2C(=O)N1OO/C(N=C1CCCC1)=[NH+]/C1=CCCC1 |
| InChI | InChI=1S/C19H19N3O4/c23-17-15-11-5-6-12-16(15)18(24)22(17)26-25-19(20-13-7-1-2-8-13)21-14-9-3-4-10-14/h5-7,11-12H,1-4,8-10H2/p+1/b20-19+ |
| InChIKey | ZEWXKPOTTIMQRF-FMQUCBEESA-O |
| XLogP | 1.67 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|