C24H31N3O — CID 154719799
1-[6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2-pyridinyl]-N-[2,6-di(propan-2-yl)phenyl]ethanimine (PubChem CID 154719799) has the molecular formula C24H31N3O and a molecular weight of 377.53 g/mol. Its IUPAC name is 1-[6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2-pyridinyl]-N-[2,6-di(propan-2-yl)phenyl]ethanimine.
| Compound Name | 1-[6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2-pyridinyl]-N-[2,6-di(propan-2-yl)phenyl]ethanimine |
|---|---|
| PubChem CID | 154719799 |
| Molecular Formula | C24H31N3O |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | 1-[6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2-pyridinyl]-N-[2,6-di(propan-2-yl)phenyl]ethanimine |
| SMILES | C/C(=N\c1c(C(C)C)cccc1C(C)C)c1cccc(C2=NC(C)(C)CO2)n1 |
| InChI | InChI=1S/C24H31N3O/c1-15(2)18-10-8-11-19(16(3)4)22(18)25-17(5)20-12-9-13-21(26-20)23-27-24(6,7)14-28-23/h8-13,15-16H,14H2,1-7H3/b25-17+ |
| InChIKey | KASJTDUDYSGNGK-KOEQRZSOSA-N |
| XLogP | 6.02 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|