C19H26O4Si — CID 154720480
8-[1-[dimethyl(phenyl)silyl]ethenyl]-1,4-dioxaspiro[4.5]decane-8-carboxylic acid (PubChem CID 154720480) has the molecular formula C19H26O4Si and a molecular weight of 346.50 g/mol. Its IUPAC name is 8-[1-[dimethyl(phenyl)silyl]ethenyl]-1,4-dioxaspiro[4.5]decane-8-carboxylic acid.
| Compound Name | 8-[1-[dimethyl(phenyl)silyl]ethenyl]-1,4-dioxaspiro[4.5]decane-8-carboxylic acid |
|---|---|
| PubChem CID | 154720480 |
| Molecular Formula | C19H26O4Si |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 8-[1-[dimethyl(phenyl)silyl]ethenyl]-1,4-dioxaspiro[4.5]decane-8-carboxylic acid |
| SMILES | C=C(C1(C(=O)O)CCC2(CC1)OCCO2)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C19H26O4Si/c1-15(24(2,3)16-7-5-4-6-8-16)18(17(20)21)9-11-19(12-10-18)22-13-14-23-19/h4-8H,1,9-14H2,2-3H3,(H,20,21) |
| InChIKey | CBIYYGUKUQIBHS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|