C21H27F3NO3+ — CID 154720689
2,2,2-trifluoroethyl (4R,5S)-4-(methoxymethyl)-5-phenyl-3-pyrrolidin-1-ium-1-ylidenehept-6-enoate (PubChem CID 154720689) has the molecular formula C21H27F3NO3+ and a molecular weight of 398.45 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl (4R,5S)-4-(methoxymethyl)-5-phenyl-3-pyrrolidin-1-ium-1-ylidenehept-6-enoate.
| Compound Name | 2,2,2-trifluoroethyl (4R,5S)-4-(methoxymethyl)-5-phenyl-3-pyrrolidin-1-ium-1-ylidenehept-6-enoate |
|---|---|
| PubChem CID | 154720689 |
| Molecular Formula | C21H27F3NO3+ |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 2,2,2-trifluoroethyl (4R,5S)-4-(methoxymethyl)-5-phenyl-3-pyrrolidin-1-ium-1-ylidenehept-6-enoate |
| SMILES | C=C[C@H](c1ccccc1)[C@@H](COC)C(CC(=O)OCC(F)(F)F)=[N+]1CCCC1 |
| InChI | InChI=1S/C21H27F3NO3/c1-3-17(16-9-5-4-6-10-16)18(14-27-2)19(25-11-7-8-12-25)13-20(26)28-15-21(22,23)24/h3-6,9-10,17-18H,1,7-8,11-15H2,2H3/q+1/t17-,18-/m1/s1 |
| InChIKey | RVCQGZRVYCWVTH-QZTJIDSGSA-N |
| XLogP | 3.96 |
| TPSA | 38.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|