C31H33N5O5 — CID 154721027
methyl (2S)-2-[[(2S)-2-azido-6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoyl]amino]-3-phenylpropanoate (PubChem CID 154721027) has the molecular formula C31H33N5O5 and a molecular weight of 555.64 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-2-azido-6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoyl]amino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[[(2S)-2-azido-6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 154721027 |
| Molecular Formula | C31H33N5O5 |
| Molecular Weight | 555.64 g/mol |
| Exact Mass | 555.25 |
| IUPAC Name | methyl (2S)-2-[[(2S)-2-azido-6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCCCNC(=O)OCC1c2ccccc2-c2ccccc21)N=[N+]=[N-] |
| InChI | InChI=1S/C31H33N5O5/c1-40-30(38)28(19-21-11-3-2-4-12-21)34-29(37)27(35-36-32)17-9-10-18-33-31(39)41-20-26-24-15-7-5-13-22(24)23-14-6-8-16-25(23)26/h2-8,11-16,26-28H,9-10,17-20H2,1H3,(H,33,39)(H,34,37)/t27-,28-/m0/s1 |
| InChIKey | UCPZHFFKXFSFIA-NSOVKSMOSA-N |
| XLogP | 5.27 |
| TPSA | 142.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.64 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|