C15H16F5NO3 — CID 154721078
ethyl 4-acetamido-2,2-difluoro-4-[4-(trifluoromethyl)phenyl]butanoate (PubChem CID 154721078) has the molecular formula C15H16F5NO3 and a molecular weight of 353.29 g/mol. Its IUPAC name is ethyl 4-acetamido-2,2-difluoro-4-[4-(trifluoromethyl)phenyl]butanoate.
| Compound Name | ethyl 4-acetamido-2,2-difluoro-4-[4-(trifluoromethyl)phenyl]butanoate |
|---|---|
| PubChem CID | 154721078 |
| Molecular Formula | C15H16F5NO3 |
| Molecular Weight | 353.29 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | ethyl 4-acetamido-2,2-difluoro-4-[4-(trifluoromethyl)phenyl]butanoate |
| SMILES | CCOC(=O)C(F)(F)CC(NC(C)=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H16F5NO3/c1-3-24-13(23)14(16,17)8-12(21-9(2)22)10-4-6-11(7-5-10)15(18,19)20/h4-7,12H,3,8H2,1-2H3,(H,21,22) |
| InChIKey | UZLSROVWWNPFND-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |