C16H11BrClF2N3OS — CID 154721224
6-(4-bromophenyl)-3-[chloro(difluoro)methyl]-4-(2-thiophen-2-ylethyl)-1,2,4-triazin-5-one (PubChem CID 154721224) has the molecular formula C16H11BrClF2N3OS and a molecular weight of 446.70 g/mol. Its IUPAC name is 6-(4-bromophenyl)-3-[chloro(difluoro)methyl]-4-(2-thiophen-2-ylethyl)-1,2,4-triazin-5-one.
| Compound Name | 6-(4-bromophenyl)-3-[chloro(difluoro)methyl]-4-(2-thiophen-2-ylethyl)-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 154721224 |
| Molecular Formula | C16H11BrClF2N3OS |
| Molecular Weight | 446.70 g/mol |
| Exact Mass | 444.95 |
| IUPAC Name | 6-(4-bromophenyl)-3-[chloro(difluoro)methyl]-4-(2-thiophen-2-ylethyl)-1,2,4-triazin-5-one |
| SMILES | O=c1c(-c2ccc(Br)cc2)nnc(C(F)(F)Cl)n1CCc1cccs1 |
| InChI | InChI=1S/C16H11BrClF2N3OS/c17-11-5-3-10(4-6-11)13-14(24)23(8-7-12-2-1-9-25-12)15(22-21-13)16(18,19)20/h1-6,9H,7-8H2 |
| InChIKey | XNLYWUVXNOOTCE-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.70 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|