C28H26BrNO4S — CID 154721510
2-bromoethyl 1-[2,4-dimethyl-6-[(4-methylphenyl)sulfonylamino]phenyl]naphthalene-2-carboxylate (PubChem CID 154721510) has the molecular formula C28H26BrNO4S and a molecular weight of 552.49 g/mol. Its IUPAC name is 2-bromoethyl 1-[2,4-dimethyl-6-[(4-methylphenyl)sulfonylamino]phenyl]naphthalene-2-carboxylate.
| Compound Name | 2-bromoethyl 1-[2,4-dimethyl-6-[(4-methylphenyl)sulfonylamino]phenyl]naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 154721510 |
| Molecular Formula | C28H26BrNO4S |
| Molecular Weight | 552.49 g/mol |
| Exact Mass | 551.08 |
| IUPAC Name | 2-bromoethyl 1-[2,4-dimethyl-6-[(4-methylphenyl)sulfonylamino]phenyl]naphthalene-2-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cc(C)cc(C)c2-c2c(C(=O)OCCBr)ccc3ccccc23)cc1 |
| InChI | InChI=1S/C28H26BrNO4S/c1-18-8-11-22(12-9-18)35(32,33)30-25-17-19(2)16-20(3)26(25)27-23-7-5-4-6-21(23)10-13-24(27)28(31)34-15-14-29/h4-13,16-17,30H,14-15H2,1-3H3 |
| InChIKey | UTNBMKFTJKQHSX-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.49 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|