C19H43IO2Si2 — CID 154722299
tert-butyl-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-iodoheptan-2-yl]oxy-dimethylsilane (PubChem CID 154722299) has the molecular formula C19H43IO2Si2 and a molecular weight of 486.63 g/mol. Its IUPAC name is tert-butyl-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-iodoheptan-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-iodoheptan-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 154722299 |
| Molecular Formula | C19H43IO2Si2 |
| Molecular Weight | 486.63 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | tert-butyl-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-iodoheptan-2-yl]oxy-dimethylsilane |
| SMILES | CC(I)C[C@@H](C[C@@H](C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H43IO2Si2/c1-15(20)13-17(22-24(11,12)19(6,7)8)14-16(2)21-23(9,10)18(3,4)5/h15-17H,13-14H2,1-12H3/t15?,16-,17+/m1/s1 |
| InChIKey | KSIAXHZRTMYOLX-FGJGXXMFSA-N |
| XLogP | 7.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.63 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|