C18H41IO2Si2 — CID 57026141
tert-butyl-[1-[tert-butyl(dimethyl)silyl]oxy-1-iodohexan-3-yl]oxy-dimethylsilane (PubChem CID 57026141) has the molecular formula C18H41IO2Si2 and a molecular weight of 472.60 g/mol. Its IUPAC name is tert-butyl-[1-[tert-butyl(dimethyl)silyl]oxy-1-iodohexan-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[1-[tert-butyl(dimethyl)silyl]oxy-1-iodohexan-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 57026141 |
| Molecular Formula | C18H41IO2Si2 |
| Molecular Weight | 472.60 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | tert-butyl-[1-[tert-butyl(dimethyl)silyl]oxy-1-iodohexan-3-yl]oxy-dimethylsilane |
| SMILES | CCCC(CC(I)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H41IO2Si2/c1-12-13-15(20-22(8,9)17(2,3)4)14-16(19)21-23(10,11)18(5,6)7/h15-16H,12-14H2,1-11H3 |
| InChIKey | RRQMZVJRKSYGIV-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.60 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|