C19H43LiO2Si2 — CID 154722514
lithium tert-butyl-[(2R,4S)-4-[tert-butyl(dimethyl)silyl]oxyheptan-2-yl]oxy-dimethylsilane (PubChem CID 154722514) has the molecular formula C19H43LiO2Si2 and a molecular weight of 366.66 g/mol. Its IUPAC name is lithium tert-butyl-[(2R,4S)-4-[tert-butyl(dimethyl)silyl]oxyheptan-2-yl]oxy-dimethylsilane.
| Compound Name | lithium tert-butyl-[(2R,4S)-4-[tert-butyl(dimethyl)silyl]oxyheptan-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 154722514 |
| Molecular Formula | C19H43LiO2Si2 |
| Molecular Weight | 366.66 g/mol |
| Exact Mass | 366.30 |
| IUPAC Name | lithium tert-butyl-[(2R,4S)-4-[tert-butyl(dimethyl)silyl]oxyheptan-2-yl]oxy-dimethylsilane |
| SMILES | C[CH-]C[C@@H](C[C@@H](C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C.[Li+] |
| InChI | InChI=1S/C19H43O2Si2.Li/c1-13-14-17(21-23(11,12)19(6,7)8)15-16(2)20-22(9,10)18(3,4)5;/h13,16-17H,14-15H2,1-12H3;/q-1;+1/t16-,17+;/m1./s1 |
| InChIKey | UVVOXKDNDCUVNP-PPPUBMIESA-N |
| XLogP | 3.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.66 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|