About copper(1+);2-methylhept-2-ene
copper(1+);2-methylhept-2-ene (PubChem CID 154722359) has the molecular formula C8H15Cu
and a molecular weight of 174.75 g/mol. Its IUPAC name is copper(1+);2-methylhept-2-ene.
Molecular Properties
| Compound Name | copper(1+);2-methylhept-2-ene |
| PubChem CID | 154722359 |
| Molecular Formula | C8H15Cu |
| Molecular Weight | 174.75 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | copper(1+);2-methylhept-2-ene |
| SMILES | C[CH-]CCC=C(C)C.[Cu+] |
| InChI | InChI=1S/C8H15.Cu/c1-4-5-6-7-8(2)3;/h4,7H,5-6H2,1-3H3;/q-1;+1 |
| InChIKey | CMZSUDIPSQVFCY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.75 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze copper(1+);2-methylhept-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper(1+);2-methylhept-2-ene?
The IUPAC name of copper(1+);2-methylhept-2-ene (CID 154722359) is copper(1+);2-methylhept-2-ene.
What is the SMILES notation for copper(1+);2-methylhept-2-ene?
The canonical SMILES for copper(1+);2-methylhept-2-ene is C[CH-]CCC=C(C)C.[Cu+].
What is the InChIKey of copper(1+);2-methylhept-2-ene?
The InChIKey is CMZSUDIPSQVFCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15.Cu/c1-4-5-6-7-8(2)3;/h4,7H,5-6H2,1-3H3;/q-1;+1.
What are the key properties of copper(1+);2-methylhept-2-ene?
copper(1+);2-methylhept-2-ene has a molecular weight of 174.75 g/mol, XLogP of 2.95, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for copper(1+);2-methylhept-2-ene is sourced from PubChem (CID 154722359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).