C28H32N2O6S2 — CID 154723041
dimethyl 2-[[[4-(dimethylamino)-2-methylsulfanylphenyl]-phenylmethyl]-(4-methylphenyl)sulfonylamino]propanedioate (PubChem CID 154723041) has the molecular formula C28H32N2O6S2 and a molecular weight of 556.71 g/mol. Its IUPAC name is dimethyl 2-[[[4-(dimethylamino)-2-methylsulfanylphenyl]-phenylmethyl]-(4-methylphenyl)sulfonylamino]propanedioate.
| Compound Name | dimethyl 2-[[[4-(dimethylamino)-2-methylsulfanylphenyl]-phenylmethyl]-(4-methylphenyl)sulfonylamino]propanedioate |
|---|---|
| PubChem CID | 154723041 |
| Molecular Formula | C28H32N2O6S2 |
| Molecular Weight | 556.71 g/mol |
| Exact Mass | 556.17 |
| IUPAC Name | dimethyl 2-[[[4-(dimethylamino)-2-methylsulfanylphenyl]-phenylmethyl]-(4-methylphenyl)sulfonylamino]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)N(C(c1ccccc1)c1ccc(N(C)C)cc1SC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C28H32N2O6S2/c1-19-12-15-22(16-13-19)38(33,34)30(26(27(31)35-4)28(32)36-5)25(20-10-8-7-9-11-20)23-17-14-21(29(2)3)18-24(23)37-6/h7-18,25-26H,1-6H3 |
| InChIKey | MPJUPEBACNXPAF-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.71 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|