C33H42N2O6S — CID 154722984
ditert-butyl 2-[[[4-(dimethylamino)phenyl]-phenylmethyl]-(4-methylphenyl)sulfonylamino]propanedioate (PubChem CID 154722984) has the molecular formula C33H42N2O6S and a molecular weight of 594.77 g/mol. Its IUPAC name is ditert-butyl 2-[[[4-(dimethylamino)phenyl]-phenylmethyl]-(4-methylphenyl)sulfonylamino]propanedioate.
| Compound Name | ditert-butyl 2-[[[4-(dimethylamino)phenyl]-phenylmethyl]-(4-methylphenyl)sulfonylamino]propanedioate |
|---|---|
| PubChem CID | 154722984 |
| Molecular Formula | C33H42N2O6S |
| Molecular Weight | 594.77 g/mol |
| Exact Mass | 594.28 |
| IUPAC Name | ditert-butyl 2-[[[4-(dimethylamino)phenyl]-phenylmethyl]-(4-methylphenyl)sulfonylamino]propanedioate |
| SMILES | Cc1ccc(S(=O)(=O)N(C(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)C(c2ccccc2)c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C33H42N2O6S/c1-23-15-21-27(22-16-23)42(38,39)35(29(30(36)40-32(2,3)4)31(37)41-33(5,6)7)28(24-13-11-10-12-14-24)25-17-19-26(20-18-25)34(8)9/h10-22,28-29H,1-9H3 |
| InChIKey | OCCHVVJFRMNHJI-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.77 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|