C9H7ClN4O2 — CID 154724441
1-(4-chloro-1,3-oxazol-2-yl)-3-pyridin-3-ylurea (PubChem CID 154724441) has the molecular formula C9H7ClN4O2 and a molecular weight of 238.63 g/mol. Its IUPAC name is 1-(4-chloro-1,3-oxazol-2-yl)-3-pyridin-3-ylurea.
| Compound Name | 1-(4-chloro-1,3-oxazol-2-yl)-3-pyridin-3-ylurea |
|---|---|
| PubChem CID | 154724441 |
| Molecular Formula | C9H7ClN4O2 |
| Molecular Weight | 238.63 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 1-(4-chloro-1,3-oxazol-2-yl)-3-pyridin-3-ylurea |
| SMILES | O=C(Nc1cccnc1)Nc1nc(Cl)co1 |
| InChI | InChI=1S/C9H7ClN4O2/c10-7-5-16-9(13-7)14-8(15)12-6-2-1-3-11-4-6/h1-5H,(H2,12,13,14,15) |
| InChIKey | QTUIEJLMTQAVQL-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.63 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |