C25H15FN4O4 — CID 154725966
1-(2,4-dinitrophenyl)-5-(4-fluorophenyl)-3-naphthalen-1-ylpyrazole (PubChem CID 154725966) has the molecular formula C25H15FN4O4 and a molecular weight of 454.42 g/mol. Its IUPAC name is 1-(2,4-dinitrophenyl)-5-(4-fluorophenyl)-3-naphthalen-1-ylpyrazole.
| Compound Name | 1-(2,4-dinitrophenyl)-5-(4-fluorophenyl)-3-naphthalen-1-ylpyrazole |
|---|---|
| PubChem CID | 154725966 |
| Molecular Formula | C25H15FN4O4 |
| Molecular Weight | 454.42 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | 1-(2,4-dinitrophenyl)-5-(4-fluorophenyl)-3-naphthalen-1-ylpyrazole |
| SMILES | O=[N+]([O-])c1ccc(-n2nc(-c3cccc4ccccc34)cc2-c2ccc(F)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H15FN4O4/c26-18-10-8-17(9-11-18)24-15-22(21-7-3-5-16-4-1-2-6-20(16)21)27-28(24)23-13-12-19(29(31)32)14-25(23)30(33)34/h1-15H |
| InChIKey | AMTYUEDXKCFSGU-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 104.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.42 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|