C16H16N6 — CID 154726599
6-(ethylamino)-4-(1H-indazol-5-ylmethylamino)pyridine-3-carbonitrile (PubChem CID 154726599) has the molecular formula C16H16N6 and a molecular weight of 292.35 g/mol. Its IUPAC name is 6-(ethylamino)-4-(1H-indazol-5-ylmethylamino)pyridine-3-carbonitrile.
| Compound Name | 6-(ethylamino)-4-(1H-indazol-5-ylmethylamino)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 154726599 |
| Molecular Formula | C16H16N6 |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 6-(ethylamino)-4-(1H-indazol-5-ylmethylamino)pyridine-3-carbonitrile |
| SMILES | CCNc1cc(NCc2ccc3[nH]ncc3c2)c(C#N)cn1 |
| InChI | InChI=1S/C16H16N6/c1-2-18-16-6-15(13(7-17)9-20-16)19-8-11-3-4-14-12(5-11)10-21-22-14/h3-6,9-10H,2,8H2,1H3,(H,21,22)(H2,18,19,20) |
| InChIKey | MXUZJLXHNGIGOV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |