About 4-chloropyrrolo[2,1-f][1,2,4]triazine-6-carboxylic acid
4-chloropyrrolo[2,1-f][1,2,4]triazine-6-carboxylic acid (PubChem CID 154729332) has the molecular formula C7H4ClN3O2
and a molecular weight of 197.58 g/mol. Its IUPAC name is 4-chloropyrrolo[2,1-f][1,2,4]triazine-6-carboxylic acid.
Analyze 4-chloropyrrolo[2,1-f][1,2,4]triazine-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloropyrrolo[2,1-f][1,2,4]triazine-6-carboxylic acid?
The IUPAC name of 4-chloropyrrolo[2,1-f][1,2,4]triazine-6-carboxylic acid (CID 154729332) is 4-chloropyrrolo[2,1-f][1,2,4]triazine-6-carboxylic acid.
What is the SMILES notation for 4-chloropyrrolo[2,1-f][1,2,4]triazine-6-carboxylic acid?
The canonical SMILES for 4-chloropyrrolo[2,1-f][1,2,4]triazine-6-carboxylic acid is O=C(O)c1cc2c(Cl)ncnn2c1.
What is the InChIKey of 4-chloropyrrolo[2,1-f][1,2,4]triazine-6-carboxylic acid?
The InChIKey is KCOFGDYUAACFJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4ClN3O2/c8-6-5-1-4(7(12)13)2-11(5)10-3-9-6/h1-3H,(H,12,13).
What are the key properties of 4-chloropyrrolo[2,1-f][1,2,4]triazine-6-carboxylic acid?
4-chloropyrrolo[2,1-f][1,2,4]triazine-6-carboxylic acid has a molecular weight of 197.58 g/mol, XLogP of 1.08, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloropyrrolo[2,1-f][1,2,4]triazine-6-carboxylic acid is sourced from PubChem (CID 154729332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).