6-chloro-[1,2,4]triazolo[1,5-b]pyridazine-7-carboxylic acid

C6H3ClN4O2 — CID 10488205

IUPAC6-chloro-[1,2,4]triazolo[1,5-b]pyridazine-7-carboxylic acid
SMILESO=C(O)c1cc2ncnn2nc1Cl
InChIInChI=1S/C6H3ClN4O2/c7-5-3(6(12)13)1-4-8-2-9-11(4)10-5/h1-2H,(H,12,13)
InChIKeyJZDQUXWPHUHOFW-UHFFFAOYSA-N
MW198.57 g/mol
LogP0.48
Rot. Bonds1

About 6-chloro-[1,2,4]triazolo[1,5-b]pyridazine-7-carboxylic acid

6-chloro-[1,2,4]triazolo[1,5-b]pyridazine-7-carboxylic acid (PubChem CID 10488205) has the molecular formula C6H3ClN4O2 and a molecular weight of 198.57 g/mol. Its IUPAC name is 6-chloro-[1,2,4]triazolo[1,5-b]pyridazine-7-carboxylic acid.

Molecular Properties

Compound Name6-chloro-[1,2,4]triazolo[1,5-b]pyridazine-7-carboxylic acid
PubChem CID10488205
Molecular FormulaC6H3ClN4O2
Molecular Weight198.57 g/mol
Exact Mass197.99
IUPAC Name6-chloro-[1,2,4]triazolo[1,5-b]pyridazine-7-carboxylic acid
SMILESO=C(O)c1cc2ncnn2nc1Cl
InChIInChI=1S/C6H3ClN4O2/c7-5-3(6(12)13)1-4-8-2-9-11(4)10-5/h1-2H,(H,12,13)
InChIKeyJZDQUXWPHUHOFW-UHFFFAOYSA-N
XLogP0.48
TPSA80.38 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500198.57
LogP ≤ 50.48
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 6-chloro-[1,2,4]triazolo[1,5-b]pyridazine-7-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-chloro-[1,2,4]triazolo[1,5-b]pyridazine-7-carboxylic acid?
The IUPAC name of 6-chloro-[1,2,4]triazolo[1,5-b]pyridazine-7-carboxylic acid (CID 10488205) is 6-chloro-[1,2,4]triazolo[1,5-b]pyridazine-7-carboxylic acid.
What is the SMILES notation for 6-chloro-[1,2,4]triazolo[1,5-b]pyridazine-7-carboxylic acid?
The canonical SMILES for 6-chloro-[1,2,4]triazolo[1,5-b]pyridazine-7-carboxylic acid is O=C(O)c1cc2ncnn2nc1Cl.
What is the InChIKey of 6-chloro-[1,2,4]triazolo[1,5-b]pyridazine-7-carboxylic acid?
The InChIKey is JZDQUXWPHUHOFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3ClN4O2/c7-5-3(6(12)13)1-4-8-2-9-11(4)10-5/h1-2H,(H,12,13).
What are the key properties of 6-chloro-[1,2,4]triazolo[1,5-b]pyridazine-7-carboxylic acid?
6-chloro-[1,2,4]triazolo[1,5-b]pyridazine-7-carboxylic acid has a molecular weight of 198.57 g/mol, XLogP of 0.48, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-[1,2,4]triazolo[1,5-b]pyridazine-7-carboxylic acid is sourced from PubChem (CID 10488205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).