C22H36N2O7 — CID 154730255
2-O,9-O-ditert-butyl 4-O-ethyl 5-oxo-2,9-diazaspiro[5.5]undecane-2,4,9-tricarboxylate (PubChem CID 154730255) has the molecular formula C22H36N2O7 and a molecular weight of 440.54 g/mol. Its IUPAC name is 2-O,9-O-ditert-butyl 4-O-ethyl 5-oxo-2,9-diazaspiro[5.5]undecane-2,4,9-tricarboxylate.
| Compound Name | 2-O,9-O-ditert-butyl 4-O-ethyl 5-oxo-2,9-diazaspiro[5.5]undecane-2,4,9-tricarboxylate |
|---|---|
| PubChem CID | 154730255 |
| Molecular Formula | C22H36N2O7 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | 2-O,9-O-ditert-butyl 4-O-ethyl 5-oxo-2,9-diazaspiro[5.5]undecane-2,4,9-tricarboxylate |
| SMILES | CCOC(=O)C1CN(C(=O)OC(C)(C)C)CC2(CCN(C(=O)OC(C)(C)C)CC2)C1=O |
| InChI | InChI=1S/C22H36N2O7/c1-8-29-17(26)15-13-24(19(28)31-21(5,6)7)14-22(16(15)25)9-11-23(12-10-22)18(27)30-20(2,3)4/h15H,8-14H2,1-7H3 |
| InChIKey | NGOXQENBJGDSBV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|