C34H52N2O13 — CID 165000264
tert-butyl 7-(2-ethoxy-2-oxoacetyl)-8-oxo-5-azaspiro[2.5]octane-5-carboxylate;tert-butyl 8-oxo-5-azaspiro[2.5]octane-5-carboxylate;diethyl oxalate (PubChem CID 165000264) has the molecular formula C34H52N2O13 and a molecular weight of 696.79 g/mol. Its IUPAC name is tert-butyl 7-(2-ethoxy-2-oxoacetyl)-8-oxo-5-azaspiro[2.5]octane-5-carboxylate;tert-butyl 8-oxo-5-azaspiro[2.5]octane-5-carboxylate;diethyl oxalate.
| Compound Name | tert-butyl 7-(2-ethoxy-2-oxoacetyl)-8-oxo-5-azaspiro[2.5]octane-5-carboxylate;tert-butyl 8-oxo-5-azaspiro[2.5]octane-5-carboxylate;diethyl oxalate |
|---|---|
| PubChem CID | 165000264 |
| Molecular Formula | C34H52N2O13 |
| Molecular Weight | 696.79 g/mol |
| Exact Mass | 696.35 |
| IUPAC Name | tert-butyl 7-(2-ethoxy-2-oxoacetyl)-8-oxo-5-azaspiro[2.5]octane-5-carboxylate;tert-butyl 8-oxo-5-azaspiro[2.5]octane-5-carboxylate;diethyl oxalate |
| SMILES | CC(C)(C)OC(=O)N1CCC(=O)C2(CC2)C1.CCOC(=O)C(=O)C1CN(C(=O)OC(C)(C)C)CC2(CC2)C1=O.CCOC(=O)C(=O)OCC |
| InChI | InChI=1S/C16H23NO6.C12H19NO3.C6H10O4/c1-5-22-13(20)11(18)10-8-17(14(21)23-15(2,3)4)9-16(6-7-16)12(10)19;1-11(2,3)16-10(15)13-7-4-9(14)12(8-13)5-6-12;1-3-9-5(7)6(8)10-4-2/h10H,5-9H2,1-4H3;4-8H2,1-3H3;3-4H2,1-2H3 |
| InChIKey | IDPCQGJILXWMDV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 189.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.79 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|