C23H27ClN2O9 — CID 154731443
(Z)-but-2-enedioic acid;3-O-ethyl 5-O-methyl 2-[(2-amino-1,1,2,2-tetradeuterioethoxy)methyl]-4-(2-chlorophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 154731443) has the molecular formula C23H27ClN2O9 and a molecular weight of 514.95 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;3-O-ethyl 5-O-methyl 2-[(2-amino-1,1,2,2-tetradeuterioethoxy)methyl]-4-(2-chlorophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | (Z)-but-2-enedioic acid;3-O-ethyl 5-O-methyl 2-[(2-amino-1,1,2,2-tetradeuterioethoxy)methyl]-4-(2-chlorophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 154731443 |
| Molecular Formula | C23H27ClN2O9 |
| Molecular Weight | 514.95 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | (Z)-but-2-enedioic acid;3-O-ethyl 5-O-methyl 2-[(2-amino-1,1,2,2-tetradeuterioethoxy)methyl]-4-(2-chlorophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | O=C(O)/C=C\C(=O)O.[2H]C([2H])(N)C([2H])([2H])OCC1=C(C(=O)OCC)C(c2ccccc2Cl)C(C(=O)OC)=CN1 |
| InChI | InChI=1S/C19H23ClN2O5.C4H4O4/c1-3-27-19(24)17-15(11-26-9-8-21)22-10-13(18(23)25-2)16(17)12-6-4-5-7-14(12)20;5-3(6)1-2-4(7)8/h4-7,10,16,22H,3,8-9,11,21H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1-/i8D2,9D2; |
| InChIKey | RGEVHDAXISMPBK-QQQFIHRYSA-N |
| XLogP | 1.59 |
| TPSA | 174.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.95 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|