C17H23ClN2O3 — CID 154739270
1-acetyl-N-[(2-chlorophenyl)methyl]-N-ethyl-3-hydroxypiperidine-3-carboxamide (PubChem CID 154739270) has the molecular formula C17H23ClN2O3 and a molecular weight of 338.83 g/mol. Its IUPAC name is 1-acetyl-N-[(2-chlorophenyl)methyl]-N-ethyl-3-hydroxypiperidine-3-carboxamide.
| Compound Name | 1-acetyl-N-[(2-chlorophenyl)methyl]-N-ethyl-3-hydroxypiperidine-3-carboxamide |
|---|---|
| PubChem CID | 154739270 |
| Molecular Formula | C17H23ClN2O3 |
| Molecular Weight | 338.83 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 1-acetyl-N-[(2-chlorophenyl)methyl]-N-ethyl-3-hydroxypiperidine-3-carboxamide |
| SMILES | CCN(Cc1ccccc1Cl)C(=O)C1(O)CCCN(C(C)=O)C1 |
| InChI | InChI=1S/C17H23ClN2O3/c1-3-19(11-14-7-4-5-8-15(14)18)16(22)17(23)9-6-10-20(12-17)13(2)21/h4-5,7-8,23H,3,6,9-12H2,1-2H3 |
| InChIKey | VUSQZTBDXGBFDF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.83 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |