C13H15Cl2N3O3 — CID 154739739
[1-(2,4-dichloro-6-hydroxybenzoyl)piperidin-4-yl]urea (PubChem CID 154739739) has the molecular formula C13H15Cl2N3O3 and a molecular weight of 332.19 g/mol. Its IUPAC name is [1-(2,4-dichloro-6-hydroxybenzoyl)piperidin-4-yl]urea.
| Compound Name | [1-(2,4-dichloro-6-hydroxybenzoyl)piperidin-4-yl]urea |
|---|---|
| PubChem CID | 154739739 |
| Molecular Formula | C13H15Cl2N3O3 |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | [1-(2,4-dichloro-6-hydroxybenzoyl)piperidin-4-yl]urea |
| SMILES | NC(=O)NC1CCN(C(=O)c2c(O)cc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C13H15Cl2N3O3/c14-7-5-9(15)11(10(19)6-7)12(20)18-3-1-8(2-4-18)17-13(16)21/h5-6,8,19H,1-4H2,(H3,16,17,21) |
| InChIKey | FDSOCICRLVQDJB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |