C18H18N4O4 — CID 154742530
3-methyl-7-(2-methyl-1-oxoisoquinoline-3-carbonyl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione (PubChem CID 154742530) has the molecular formula C18H18N4O4 and a molecular weight of 354.37 g/mol. Its IUPAC name is 3-methyl-7-(2-methyl-1-oxoisoquinoline-3-carbonyl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 3-methyl-7-(2-methyl-1-oxoisoquinoline-3-carbonyl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 154742530 |
| Molecular Formula | C18H18N4O4 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 3-methyl-7-(2-methyl-1-oxoisoquinoline-3-carbonyl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
| SMILES | CN1C(=O)NC2(CCN(C(=O)c3cc4ccccc4c(=O)n3C)C2)C1=O |
| InChI | InChI=1S/C18H18N4O4/c1-20-13(9-11-5-3-4-6-12(11)14(20)23)15(24)22-8-7-18(10-22)16(25)21(2)17(26)19-18/h3-6,9H,7-8,10H2,1-2H3,(H,19,26) |
| InChIKey | ITRGTGPCVFYULD-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 91.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|