C13H15NO7S — CID 154743279
5-[[2-methoxy-1-(5-methylfuran-2-yl)ethyl]sulfamoyl]furan-3-carboxylic acid (PubChem CID 154743279) has the molecular formula C13H15NO7S and a molecular weight of 329.33 g/mol. Its IUPAC name is 5-[[2-methoxy-1-(5-methylfuran-2-yl)ethyl]sulfamoyl]furan-3-carboxylic acid.
| Compound Name | 5-[[2-methoxy-1-(5-methylfuran-2-yl)ethyl]sulfamoyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 154743279 |
| Molecular Formula | C13H15NO7S |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 5-[[2-methoxy-1-(5-methylfuran-2-yl)ethyl]sulfamoyl]furan-3-carboxylic acid |
| SMILES | COCC(NS(=O)(=O)c1cc(C(=O)O)co1)c1ccc(C)o1 |
| InChI | InChI=1S/C13H15NO7S/c1-8-3-4-11(21-8)10(7-19-2)14-22(17,18)12-5-9(6-20-12)13(15)16/h3-6,10,14H,7H2,1-2H3,(H,15,16) |
| InChIKey | ZFEQHYOZXSPCTN-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |