C20H23N3OS — CID 154746149
2-phenyl-N-(1,2,3,4-tetrahydroquinolin-6-yl)thiomorpholine-4-carboxamide (PubChem CID 154746149) has the molecular formula C20H23N3OS and a molecular weight of 353.49 g/mol. Its IUPAC name is 2-phenyl-N-(1,2,3,4-tetrahydroquinolin-6-yl)thiomorpholine-4-carboxamide.
| Compound Name | 2-phenyl-N-(1,2,3,4-tetrahydroquinolin-6-yl)thiomorpholine-4-carboxamide |
|---|---|
| PubChem CID | 154746149 |
| Molecular Formula | C20H23N3OS |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 2-phenyl-N-(1,2,3,4-tetrahydroquinolin-6-yl)thiomorpholine-4-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)CCCN2)N1CCSC(c2ccccc2)C1 |
| InChI | InChI=1S/C20H23N3OS/c24-20(22-17-8-9-18-16(13-17)7-4-10-21-18)23-11-12-25-19(14-23)15-5-2-1-3-6-15/h1-3,5-6,8-9,13,19,21H,4,7,10-12,14H2,(H,22,24) |
| InChIKey | WLTAABMOUDECTG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |