C14H20FN3O3S — CID 154750779
2-fluoro-N-methyl-5-[3-(methylamino)piperidine-1-carbonyl]benzenesulfonamide (PubChem CID 154750779) has the molecular formula C14H20FN3O3S and a molecular weight of 329.40 g/mol. Its IUPAC name is 2-fluoro-N-methyl-5-[3-(methylamino)piperidine-1-carbonyl]benzenesulfonamide.
| Compound Name | 2-fluoro-N-methyl-5-[3-(methylamino)piperidine-1-carbonyl]benzenesulfonamide |
|---|---|
| PubChem CID | 154750779 |
| Molecular Formula | C14H20FN3O3S |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 2-fluoro-N-methyl-5-[3-(methylamino)piperidine-1-carbonyl]benzenesulfonamide |
| SMILES | CNC1CCCN(C(=O)c2ccc(F)c(S(=O)(=O)NC)c2)C1 |
| InChI | InChI=1S/C14H20FN3O3S/c1-16-11-4-3-7-18(9-11)14(19)10-5-6-12(15)13(8-10)22(20,21)17-2/h5-6,8,11,16-17H,3-4,7,9H2,1-2H3 |
| InChIKey | QEMMUDCLRZWSKE-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |