C15H14N2O3S — CID 154753906
(2-oxo-3,4-dihydro-1H-quinolin-7-yl) 2,5-dimethyl-1,3-thiazole-4-carboxylate (PubChem CID 154753906) has the molecular formula C15H14N2O3S and a molecular weight of 302.36 g/mol. Its IUPAC name is (2-oxo-3,4-dihydro-1H-quinolin-7-yl) 2,5-dimethyl-1,3-thiazole-4-carboxylate.
| Compound Name | (2-oxo-3,4-dihydro-1H-quinolin-7-yl) 2,5-dimethyl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 154753906 |
| Molecular Formula | C15H14N2O3S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | (2-oxo-3,4-dihydro-1H-quinolin-7-yl) 2,5-dimethyl-1,3-thiazole-4-carboxylate |
| SMILES | Cc1nc(C(=O)Oc2ccc3c(c2)NC(=O)CC3)c(C)s1 |
| InChI | InChI=1S/C15H14N2O3S/c1-8-14(16-9(2)21-8)15(19)20-11-5-3-10-4-6-13(18)17-12(10)7-11/h3,5,7H,4,6H2,1-2H3,(H,17,18) |
| InChIKey | HADFRROHKUYGMI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|