C13H11N3O3 — CID 99823234
(2-oxo-3,4-dihydro-1H-quinolin-7-yl) 1H-pyrazole-5-carboxylate (PubChem CID 99823234) has the molecular formula C13H11N3O3 and a molecular weight of 257.25 g/mol. Its IUPAC name is (2-oxo-3,4-dihydro-1H-quinolin-7-yl) 1H-pyrazole-5-carboxylate.
| Compound Name | (2-oxo-3,4-dihydro-1H-quinolin-7-yl) 1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 99823234 |
| Molecular Formula | C13H11N3O3 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | (2-oxo-3,4-dihydro-1H-quinolin-7-yl) 1H-pyrazole-5-carboxylate |
| SMILES | O=C1CCc2ccc(OC(=O)c3ccn[nH]3)cc2N1 |
| InChI | InChI=1S/C13H11N3O3/c17-12-4-2-8-1-3-9(7-11(8)15-12)19-13(18)10-5-6-14-16-10/h1,3,5-7H,2,4H2,(H,14,16)(H,15,17) |
| InChIKey | XSWMPDNRBXGRIM-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|