C18H16N4O3 — CID 99823242
(2-oxo-3,4-dihydro-1H-quinolin-7-yl) 1-methyl-5-pyrrol-1-ylpyrazole-4-carboxylate (PubChem CID 99823242) has the molecular formula C18H16N4O3 and a molecular weight of 336.35 g/mol. Its IUPAC name is (2-oxo-3,4-dihydro-1H-quinolin-7-yl) 1-methyl-5-pyrrol-1-ylpyrazole-4-carboxylate.
| Compound Name | (2-oxo-3,4-dihydro-1H-quinolin-7-yl) 1-methyl-5-pyrrol-1-ylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 99823242 |
| Molecular Formula | C18H16N4O3 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | (2-oxo-3,4-dihydro-1H-quinolin-7-yl) 1-methyl-5-pyrrol-1-ylpyrazole-4-carboxylate |
| SMILES | Cn1ncc(C(=O)Oc2ccc3c(c2)NC(=O)CC3)c1-n1cccc1 |
| InChI | InChI=1S/C18H16N4O3/c1-21-17(22-8-2-3-9-22)14(11-19-21)18(24)25-13-6-4-12-5-7-16(23)20-15(12)10-13/h2-4,6,8-11H,5,7H2,1H3,(H,20,23) |
| InChIKey | YKNYAOXIPBWLNZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|