C17H18BrClN4O2 — CID 154755220
1-[3-(2-aminopyrimidin-4-yl)piperidin-1-yl]-2-(4-bromo-2-chlorophenoxy)ethanone (PubChem CID 154755220) has the molecular formula C17H18BrClN4O2 and a molecular weight of 425.71 g/mol. Its IUPAC name is 1-[3-(2-aminopyrimidin-4-yl)piperidin-1-yl]-2-(4-bromo-2-chlorophenoxy)ethanone.
| Compound Name | 1-[3-(2-aminopyrimidin-4-yl)piperidin-1-yl]-2-(4-bromo-2-chlorophenoxy)ethanone |
|---|---|
| PubChem CID | 154755220 |
| Molecular Formula | C17H18BrClN4O2 |
| Molecular Weight | 425.71 g/mol |
| Exact Mass | 424.03 |
| IUPAC Name | 1-[3-(2-aminopyrimidin-4-yl)piperidin-1-yl]-2-(4-bromo-2-chlorophenoxy)ethanone |
| SMILES | Nc1nccc(C2CCCN(C(=O)COc3ccc(Br)cc3Cl)C2)n1 |
| InChI | InChI=1S/C17H18BrClN4O2/c18-12-3-4-15(13(19)8-12)25-10-16(24)23-7-1-2-11(9-23)14-5-6-21-17(20)22-14/h3-6,8,11H,1-2,7,9-10H2,(H2,20,21,22) |
| InChIKey | JMRZPBNIBHXTTI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.71 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |