C16H16ClN5O3 — CID 124878814
[(3R)-3-(2-aminopyrimidin-4-yl)piperidin-1-yl]-(2-chloro-4-nitrophenyl)methanone (PubChem CID 124878814) has the molecular formula C16H16ClN5O3 and a molecular weight of 361.79 g/mol. Its IUPAC name is [(3R)-3-(2-aminopyrimidin-4-yl)piperidin-1-yl]-(2-chloro-4-nitrophenyl)methanone.
| Compound Name | [(3R)-3-(2-aminopyrimidin-4-yl)piperidin-1-yl]-(2-chloro-4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 124878814 |
| Molecular Formula | C16H16ClN5O3 |
| Molecular Weight | 361.79 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | [(3R)-3-(2-aminopyrimidin-4-yl)piperidin-1-yl]-(2-chloro-4-nitrophenyl)methanone |
| SMILES | Nc1nccc([C@@H]2CCCN(C(=O)c3ccc([N+](=O)[O-])cc3Cl)C2)n1 |
| InChI | InChI=1S/C16H16ClN5O3/c17-13-8-11(22(24)25)3-4-12(13)15(23)21-7-1-2-10(9-21)14-5-6-19-16(18)20-14/h3-6,8,10H,1-2,7,9H2,(H2,18,19,20)/t10-/m1/s1 |
| InChIKey | AQOQUDLSXFPKCS-SNVBAGLBSA-N |
| XLogP | 2.64 |
| TPSA | 115.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.79 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|