C17H23FN2O4 — CID 154755288
1-[4-(2-ethoxyphenoxy)butanoyl]-3-fluoropyrrolidine-3-carboxamide (PubChem CID 154755288) has the molecular formula C17H23FN2O4 and a molecular weight of 338.38 g/mol. Its IUPAC name is 1-[4-(2-ethoxyphenoxy)butanoyl]-3-fluoropyrrolidine-3-carboxamide.
| Compound Name | 1-[4-(2-ethoxyphenoxy)butanoyl]-3-fluoropyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 154755288 |
| Molecular Formula | C17H23FN2O4 |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 1-[4-(2-ethoxyphenoxy)butanoyl]-3-fluoropyrrolidine-3-carboxamide |
| SMILES | CCOc1ccccc1OCCCC(=O)N1CCC(F)(C(N)=O)C1 |
| InChI | InChI=1S/C17H23FN2O4/c1-2-23-13-6-3-4-7-14(13)24-11-5-8-15(21)20-10-9-17(18,12-20)16(19)22/h3-4,6-7H,2,5,8-12H2,1H3,(H2,19,22) |
| InChIKey | HMGNMLSBCMVLPU-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|