C16H19N3O5S2 — CID 154755350
methyl 3-[[3-[ethylcarbamoyl(methyl)amino]phenyl]sulfamoyl]thiophene-2-carboxylate (PubChem CID 154755350) has the molecular formula C16H19N3O5S2 and a molecular weight of 397.48 g/mol. Its IUPAC name is methyl 3-[[3-[ethylcarbamoyl(methyl)amino]phenyl]sulfamoyl]thiophene-2-carboxylate.
| Compound Name | methyl 3-[[3-[ethylcarbamoyl(methyl)amino]phenyl]sulfamoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 154755350 |
| Molecular Formula | C16H19N3O5S2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | methyl 3-[[3-[ethylcarbamoyl(methyl)amino]phenyl]sulfamoyl]thiophene-2-carboxylate |
| SMILES | CCNC(=O)N(C)c1cccc(NS(=O)(=O)c2ccsc2C(=O)OC)c1 |
| InChI | InChI=1S/C16H19N3O5S2/c1-4-17-16(21)19(2)12-7-5-6-11(10-12)18-26(22,23)13-8-9-25-14(13)15(20)24-3/h5-10,18H,4H2,1-3H3,(H,17,21) |
| InChIKey | GIZXGKPUGSKQCZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |