C11H7F3N4O — CID 154758058
N-pyrimidin-2-yl-5-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 154758058) has the molecular formula C11H7F3N4O and a molecular weight of 268.20 g/mol. Its IUPAC name is N-pyrimidin-2-yl-5-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-pyrimidin-2-yl-5-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 154758058 |
| Molecular Formula | C11H7F3N4O |
| Molecular Weight | 268.20 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | N-pyrimidin-2-yl-5-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1ncccn1)c1cncc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H7F3N4O/c12-11(13,14)8-4-7(5-15-6-8)9(19)18-10-16-2-1-3-17-10/h1-6H,(H,16,17,18,19) |
| InChIKey | LZSRNAGWGWBSKK-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.20 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |