C18H24N2O4S — CID 154758985
3-[1-(3,4-dimethoxyphenyl)propyl]-8-thia-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 154758985) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is 3-[1-(3,4-dimethoxyphenyl)propyl]-8-thia-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[1-(3,4-dimethoxyphenyl)propyl]-8-thia-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 154758985 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 3-[1-(3,4-dimethoxyphenyl)propyl]-8-thia-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CCC(c1ccc(OC)c(OC)c1)N1C(=O)NC2(CCSCC2)C1=O |
| InChI | InChI=1S/C18H24N2O4S/c1-4-13(12-5-6-14(23-2)15(11-12)24-3)20-16(21)18(19-17(20)22)7-9-25-10-8-18/h5-6,11,13H,4,7-10H2,1-3H3,(H,19,22) |
| InChIKey | OCSVQXYACNGQNR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|