C12H16BrNO4S2 — CID 154759590
N-(4-bromophenyl)-1-(1,1-dioxothian-3-yl)methanesulfonamide (PubChem CID 154759590) has the molecular formula C12H16BrNO4S2 and a molecular weight of 382.30 g/mol. Its IUPAC name is N-(4-bromophenyl)-1-(1,1-dioxothian-3-yl)methanesulfonamide.
| Compound Name | N-(4-bromophenyl)-1-(1,1-dioxothian-3-yl)methanesulfonamide |
|---|---|
| PubChem CID | 154759590 |
| Molecular Formula | C12H16BrNO4S2 |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 380.97 |
| IUPAC Name | N-(4-bromophenyl)-1-(1,1-dioxothian-3-yl)methanesulfonamide |
| SMILES | O=S1(=O)CCCC(CS(=O)(=O)Nc2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C12H16BrNO4S2/c13-11-3-5-12(6-4-11)14-20(17,18)9-10-2-1-7-19(15,16)8-10/h3-6,10,14H,1-2,7-9H2 |
| InChIKey | ARARJKHDTDVHDD-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |