C15H20N4O2 — CID 154763877
2-hydroxy-1-(3-pyrrolidin-1-yl-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-6-yl)but-3-en-1-one (PubChem CID 154763877) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-hydroxy-1-(3-pyrrolidin-1-yl-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-6-yl)but-3-en-1-one.
| Compound Name | 2-hydroxy-1-(3-pyrrolidin-1-yl-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-6-yl)but-3-en-1-one |
|---|---|
| PubChem CID | 154763877 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 2-hydroxy-1-(3-pyrrolidin-1-yl-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-6-yl)but-3-en-1-one |
| SMILES | C=CC(O)C(=O)N1CCc2nnc(N3CCCC3)cc2C1 |
| InChI | InChI=1S/C15H20N4O2/c1-2-13(20)15(21)19-8-5-12-11(10-19)9-14(17-16-12)18-6-3-4-7-18/h2,9,13,20H,1,3-8,10H2 |
| InChIKey | ULXAHBNYPYUEBV-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|