C17H25BrFN3O — CID 154764121
1-(2-bromo-3-fluoro-6-methylphenyl)-3-[(1-tert-butylpyrrolidin-3-yl)methyl]urea (PubChem CID 154764121) has the molecular formula C17H25BrFN3O and a molecular weight of 386.31 g/mol. Its IUPAC name is 1-(2-bromo-3-fluoro-6-methylphenyl)-3-[(1-tert-butylpyrrolidin-3-yl)methyl]urea.
| Compound Name | 1-(2-bromo-3-fluoro-6-methylphenyl)-3-[(1-tert-butylpyrrolidin-3-yl)methyl]urea |
|---|---|
| PubChem CID | 154764121 |
| Molecular Formula | C17H25BrFN3O |
| Molecular Weight | 386.31 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 1-(2-bromo-3-fluoro-6-methylphenyl)-3-[(1-tert-butylpyrrolidin-3-yl)methyl]urea |
| SMILES | Cc1ccc(F)c(Br)c1NC(=O)NCC1CCN(C(C)(C)C)C1 |
| InChI | InChI=1S/C17H25BrFN3O/c1-11-5-6-13(19)14(18)15(11)21-16(23)20-9-12-7-8-22(10-12)17(2,3)4/h5-6,12H,7-10H2,1-4H3,(H2,20,21,23) |
| InChIKey | OROYDMNFYDBABO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.31 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |