About methyl 2-[[[dimethyl(oxo)-λ6-sulfanylidene]amino]sulfonylamino]-6-fluorobenzoate
methyl 2-[[[dimethyl(oxo)-λ6-sulfanylidene]amino]sulfonylamino]-6-fluorobenzoate (PubChem CID 154764840) has the molecular formula C10H13FN2O5S2
and a molecular weight of 324.36 g/mol. Its IUPAC name is methyl 2-[[[dimethyl(oxo)-λ6-sulfanylidene]amino]sulfonylamino]-6-fluorobenzoate.
Molecular Properties
| Compound Name | methyl 2-[[[dimethyl(oxo)-λ6-sulfanylidene]amino]sulfonylamino]-6-fluorobenzoate |
| PubChem CID | 154764840 |
| Molecular Formula | C10H13FN2O5S2 |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | methyl 2-[[[dimethyl(oxo)-λ6-sulfanylidene]amino]sulfonylamino]-6-fluorobenzoate |
| SMILES | COC(=O)c1c(F)cccc1NS(=O)(=O)N=S(C)(C)=O |
| InChI | InChI=1S/C10H13FN2O5S2/c1-18-10(14)9-7(11)5-4-6-8(9)12-20(16,17)13-19(2,3)15/h4-6,12H,1-3H3 |
| InChIKey | FECWPGUKLMHNEL-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-[[[dimethyl(oxo)-λ6-sulfanylidene]amino]sulfonylamino]-6-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[[dimethyl(oxo)-λ6-sulfanylidene]amino]sulfonylamino]-6-fluorobenzoate?
The IUPAC name of methyl 2-[[[dimethyl(oxo)-λ6-sulfanylidene]amino]sulfonylamino]-6-fluorobenzoate (CID 154764840) is methyl 2-[[[dimethyl(oxo)-λ6-sulfanylidene]amino]sulfonylamino]-6-fluorobenzoate.
What is the SMILES notation for methyl 2-[[[dimethyl(oxo)-λ6-sulfanylidene]amino]sulfonylamino]-6-fluorobenzoate?
The canonical SMILES for methyl 2-[[[dimethyl(oxo)-λ6-sulfanylidene]amino]sulfonylamino]-6-fluorobenzoate is COC(=O)c1c(F)cccc1NS(=O)(=O)N=S(C)(C)=O.
What is the InChIKey of methyl 2-[[[dimethyl(oxo)-λ6-sulfanylidene]amino]sulfonylamino]-6-fluorobenzoate?
The InChIKey is FECWPGUKLMHNEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13FN2O5S2/c1-18-10(14)9-7(11)5-4-6-8(9)12-20(16,17)13-19(2,3)15/h4-6,12H,1-3H3.
What are the key properties of methyl 2-[[[dimethyl(oxo)-λ6-sulfanylidene]amino]sulfonylamino]-6-fluorobenzoate?
methyl 2-[[[dimethyl(oxo)-λ6-sulfanylidene]amino]sulfonylamino]-6-fluorobenzoate has a molecular weight of 324.36 g/mol, XLogP of 1.00, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[[dimethyl(oxo)-λ6-sulfanylidene]amino]sulfonylamino]-6-fluorobenzoate is sourced from PubChem (CID 154764840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).