C18H21N3O2 — CID 154766880
N-[2-(2,4-dimethylphenyl)ethyl]-N'-(2-methyl-4-pyridinyl)oxamide (PubChem CID 154766880) has the molecular formula C18H21N3O2 and a molecular weight of 311.39 g/mol. Its IUPAC name is N-[2-(2,4-dimethylphenyl)ethyl]-N'-(2-methyl-4-pyridinyl)oxamide.
| Compound Name | N-[2-(2,4-dimethylphenyl)ethyl]-N'-(2-methyl-4-pyridinyl)oxamide |
|---|---|
| PubChem CID | 154766880 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | N-[2-(2,4-dimethylphenyl)ethyl]-N'-(2-methyl-4-pyridinyl)oxamide |
| SMILES | Cc1ccc(CCNC(=O)C(=O)Nc2ccnc(C)c2)c(C)c1 |
| InChI | InChI=1S/C18H21N3O2/c1-12-4-5-15(13(2)10-12)6-8-20-17(22)18(23)21-16-7-9-19-14(3)11-16/h4-5,7,9-11H,6,8H2,1-3H3,(H,20,22)(H,19,21,23) |
| InChIKey | HCJJNRPBGQRVQI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|